PNG  IHDRX cHRMz&u0`:pQ<bKGD pHYsodtIME MeqIDATxw]Wug^Qd˶ 6`!N:!@xI~)%7%@Bh&`lnjVF29gΨ4E$|>cɚ{gk= %,a KX%,a KX%,a KX%,a KX%,a KX%,a KX%, b` ǟzeאfp]<!SJmɤY޲ڿ,%c ~ع9VH.!Ͳz&QynֺTkRR.BLHi٪:l;@(!MԴ=žI,:o&N'Kù\vRmJ雵֫AWic H@" !: Cé||]k-Ha oݜ:y F())u]aG7*JV@J415p=sZH!=!DRʯvɱh~V\}v/GKY$n]"X"}t@ xS76^[bw4dsce)2dU0 CkMa-U5tvLƀ~mlMwfGE/-]7XAƟ`׮g ewxwC4\[~7@O-Q( a*XGƒ{ ՟}$_y3tĐƤatgvێi|K=uVyrŲlLӪuܿzwk$m87k( `múcE)"@rK( z4$D; 2kW=Xb$V[Ru819קR~qloѱDyįݎ*mxw]y5e4K@ЃI0A D@"BDk_)N\8͜9dz"fK0zɿvM /.:2O{ Nb=M=7>??Zuo32 DLD@D| &+֎C #B8ַ`bOb $D#ͮҪtx]%`ES`Ru[=¾!@Od37LJ0!OIR4m]GZRJu$‡c=%~s@6SKy?CeIh:[vR@Lh | (BhAMy=݃  G"'wzn޺~8ԽSh ~T*A:xR[ܹ?X[uKL_=fDȊ؂p0}7=D$Ekq!/t.*2ʼnDbŞ}DijYaȲ(""6HA;:LzxQ‘(SQQ}*PL*fc\s `/d'QXW, e`#kPGZuŞuO{{wm[&NBTiiI0bukcA9<4@SӊH*؎4U/'2U5.(9JuDfrޱtycU%j(:RUbArLֺN)udA':uGQN"-"Is.*+k@ `Ojs@yU/ H:l;@yyTn}_yw!VkRJ4P)~y#)r,D =ě"Q]ci'%HI4ZL0"MJy 8A{ aN<8D"1#IJi >XjX֔#@>-{vN!8tRݻ^)N_╗FJEk]CT՟ YP:_|H1@ CBk]yKYp|og?*dGvzنzӴzjֺNkC~AbZƷ`.H)=!QͷVTT(| u78y֮}|[8-Vjp%2JPk[}ԉaH8Wpqhwr:vWª<}l77_~{s۴V+RCģ%WRZ\AqHifɤL36: #F:p]Bq/z{0CU6ݳEv_^k7'>sq*+kH%a`0ԣisqにtү04gVgW΂iJiS'3w.w}l6MC2uԯ|>JF5`fV5m`Y**Db1FKNttu]4ccsQNnex/87+}xaUW9y>ͯ骵G{䩓Գ3+vU}~jJ.NFRD7<aJDB1#ҳgSb,+CS?/ VG J?|?,2#M9}B)MiE+G`-wo߫V`fio(}S^4e~V4bHOYb"b#E)dda:'?}׮4繏`{7Z"uny-?ǹ;0MKx{:_pÚmFמ:F " .LFQLG)Q8qN q¯¯3wOvxDb\. BKD9_NN &L:4D{mm o^tֽ:q!ƥ}K+<"m78N< ywsard5+вz~mnG)=}lYݧNj'QJS{S :UYS-952?&O-:W}(!6Mk4+>A>j+i|<<|;ر^߉=HE|V#F)Emm#}/"y GII웻Jі94+v뾧xu~5C95~ūH>c@덉pʃ1/4-A2G%7>m;–Y,cyyaln" ?ƻ!ʪ<{~h~i y.zZB̃/,雋SiC/JFMmBH&&FAbϓO^tubbb_hZ{_QZ-sύodFgO(6]TJA˯#`۶ɟ( %$&+V'~hiYy>922 Wp74Zkq+Ovn錄c>8~GqܲcWꂎz@"1A.}T)uiW4="jJ2W7mU/N0gcqܗOO}?9/wìXžΏ0 >֩(V^Rh32!Hj5`;O28؇2#ݕf3 ?sJd8NJ@7O0 b־?lldщ̡&|9C.8RTWwxWy46ah嘦mh٤&l zCy!PY?: CJyв]dm4ǜҐR޻RլhX{FƯanшQI@x' ao(kUUuxW_Ñ줮[w8 FRJ(8˼)_mQ _!RJhm=!cVmm ?sFOnll6Qk}alY}; "baӌ~M0w,Ggw2W:G/k2%R,_=u`WU R.9T"v,<\Ik޽/2110Ӿxc0gyC&Ny޽JҢrV6N ``یeA16"J³+Rj*;BϜkZPJaÍ<Jyw:NP8/D$ 011z֊Ⱳ3ι֘k1V_"h!JPIΣ'ɜ* aEAd:ݺ>y<}Lp&PlRfTb1]o .2EW\ͮ]38؋rTJsǏP@芎sF\> P^+dYJLbJ C-xϐn> ι$nj,;Ǖa FU *择|h ~izť3ᤓ`K'-f tL7JK+vf2)V'-sFuB4i+m+@My=O҈0"|Yxoj,3]:cо3 $#uŘ%Y"y죯LebqtҢVzq¼X)~>4L׶m~[1_k?kxֺQ`\ |ٛY4Ѯr!)N9{56(iNq}O()Em]=F&u?$HypWUeB\k]JɩSع9 Zqg4ZĊo oMcjZBU]B\TUd34ݝ~:7ڶSUsB0Z3srx 7`:5xcx !qZA!;%͚7&P H<WL!džOb5kF)xor^aujƍ7 Ǡ8/p^(L>ὴ-B,{ۇWzֺ^k]3\EE@7>lYBȝR.oHnXO/}sB|.i@ɥDB4tcm,@ӣgdtJ!lH$_vN166L__'Z)y&kH;:,Y7=J 9cG) V\hjiE;gya~%ks_nC~Er er)muuMg2;֫R)Md) ,¶ 2-wr#F7<-BBn~_(o=KO㭇[Xv eN_SMgSҐ BS헃D%g_N:/pe -wkG*9yYSZS.9cREL !k}<4_Xs#FmҶ:7R$i,fi!~' # !6/S6y@kZkZcX)%5V4P]VGYq%H1!;e1MV<!ϐHO021Dp= HMs~~a)ަu7G^];git!Frl]H/L$=AeUvZE4P\.,xi {-~p?2b#amXAHq)MWǾI_r`S Hz&|{ +ʖ_= (YS(_g0a03M`I&'9vl?MM+m~}*xT۲(fY*V4x@29s{DaY"toGNTO+xCAO~4Ϳ;p`Ѫ:>Ҵ7K 3}+0 387x\)a"/E>qpWB=1 ¨"MP(\xp߫́A3+J] n[ʼnӼaTbZUWb={~2ooKױӰp(CS\S筐R*JغV&&"FA}J>G֐p1ٸbk7 ŘH$JoN <8s^yk_[;gy-;߉DV{c B yce% aJhDȶ 2IdйIB/^n0tNtџdcKj4϶v~- CBcgqx9= PJ) dMsjpYB] GD4RDWX +h{y`,3ꊕ$`zj*N^TP4L:Iz9~6s) Ga:?y*J~?OrMwP\](21sZUD ?ܟQ5Q%ggW6QdO+\@ ̪X'GxN @'4=ˋ+*VwN ne_|(/BDfj5(Dq<*tNt1х!MV.C0 32b#?n0pzj#!38}޴o1KovCJ`8ŗ_"]] rDUy޲@ Ȗ-;xџ'^Y`zEd?0„ DAL18IS]VGq\4o !swV7ˣι%4FѮ~}6)OgS[~Q vcYbL!wG3 7띸*E Pql8=jT\꘿I(z<[6OrR8ºC~ډ]=rNl[g|v TMTղb-o}OrP^Q]<98S¤!k)G(Vkwyqyr޽Nv`N/e p/~NAOk \I:G6]4+K;j$R:Mi #*[AȚT,ʰ,;N{HZTGMoּy) ]%dHء9Պ䠬|<45,\=[bƟ8QXeB3- &dҩ^{>/86bXmZ]]yޚN[(WAHL$YAgDKp=5GHjU&99v簪C0vygln*P)9^͞}lMuiH!̍#DoRBn9l@ xA/_v=ȺT{7Yt2N"4!YN`ae >Q<XMydEB`VU}u]嫇.%e^ánE87Mu\t`cP=AD/G)sI"@MP;)]%fH9'FNsj1pVhY&9=0pfuJ&gޤx+k:!r˭wkl03׼Ku C &ѓYt{.O.zҏ z}/tf_wEp2gvX)GN#I ݭ߽v/ .& и(ZF{e"=V!{zW`, ]+LGz"(UJp|j( #V4, 8B 0 9OkRrlɱl94)'VH9=9W|>PS['G(*I1==C<5"Pg+x'K5EMd؞Af8lG ?D FtoB[je?{k3zQ vZ;%Ɠ,]E>KZ+T/ EJxOZ1i #T<@ I}q9/t'zi(EMqw`mYkU6;[t4DPeckeM;H}_g pMww}k6#H㶏+b8雡Sxp)&C $@'b,fPߑt$RbJ'vznuS ~8='72_`{q纶|Q)Xk}cPz9p7O:'|G~8wx(a 0QCko|0ASD>Ip=4Q, d|F8RcU"/KM opKle M3#i0c%<7׿p&pZq[TR"BpqauIp$ 8~Ĩ!8Սx\ւdT>>Z40ks7 z2IQ}ItԀ<-%S⍤};zIb$I 5K}Q͙D8UguWE$Jh )cu4N tZl+[]M4k8֦Zeq֮M7uIqG 1==tLtR,ƜSrHYt&QP윯Lg' I,3@P'}'R˪e/%-Auv·ñ\> vDJzlӾNv5:|K/Jb6KI9)Zh*ZAi`?S {aiVDԲuy5W7pWeQJk֤#5&V<̺@/GH?^τZL|IJNvI:'P=Ϛt"¨=cud S Q.Ki0 !cJy;LJR;G{BJy޺[^8fK6)=yʊ+(k|&xQ2`L?Ȓ2@Mf 0C`6-%pKpm')c$׻K5[J*U[/#hH!6acB JA _|uMvDyk y)6OPYjœ50VT K}cǻP[ $:]4MEA.y)|B)cf-A?(e|lɉ#P9V)[9t.EiQPDѠ3ϴ;E:+Օ t ȥ~|_N2,ZJLt4! %ա]u {+=p.GhNcŞQI?Nd'yeh n7zi1DB)1S | S#ًZs2|Ɛy$F SxeX{7Vl.Src3E℃Q>b6G ўYCmtկ~=K0f(=LrAS GN'ɹ9<\!a`)֕y[uՍ[09` 9 +57ts6}b4{oqd+J5fa/,97J#6yν99mRWxJyѡyu_TJc`~W>l^q#Ts#2"nD1%fS)FU w{ܯ R{ ˎ󅃏џDsZSQS;LV;7 Od1&1n$ N /.q3~eNɪ]E#oM~}v֯FڦwyZ=<<>Xo稯lfMFV6p02|*=tV!c~]fa5Y^Q_WN|Vs 0ҘދU97OI'N2'8N֭fgg-}V%y]U4 峧p*91#9U kCac_AFңĪy뚇Y_AiuYyTTYЗ-(!JFLt›17uTozc. S;7A&&<ԋ5y;Ro+:' *eYJkWR[@F %SHWP 72k4 qLd'J "zB6{AC0ƁA6U.'F3:Ȅ(9ΜL;D]m8ڥ9}dU "v!;*13Rg^fJyShyy5auA?ɩGHRjo^]׽S)Fm\toy 4WQS@mE#%5ʈfFYDX ~D5Ϡ9tE9So_aU4?Ѽm%&c{n>.KW1Tlb}:j uGi(JgcYj0qn+>) %\!4{LaJso d||u//P_y7iRJ߬nHOy) l+@$($VFIQ9%EeKʈU. ia&FY̒mZ=)+qqoQn >L!qCiDB;Y<%} OgBxB!ØuG)WG9y(Ą{_yesuZmZZey'Wg#C~1Cev@0D $a@˲(.._GimA:uyw֬%;@!JkQVM_Ow:P.s\)ot- ˹"`B,e CRtaEUP<0'}r3[>?G8xU~Nqu;Wm8\RIkբ^5@k+5(By'L&'gBJ3ݶ!/㮻w҅ yqPWUg<e"Qy*167΃sJ\oz]T*UQ<\FԎ`HaNmڜ6DysCask8wP8y9``GJ9lF\G g's Nn͵MLN֪u$| /|7=]O)6s !ĴAKh]q_ap $HH'\1jB^s\|- W1:=6lJBqjY^LsPk""`]w)󭃈,(HC ?䔨Y$Sʣ{4Z+0NvQkhol6C.婧/u]FwiVjZka&%6\F*Ny#8O,22+|Db~d ~Çwc N:FuuCe&oZ(l;@ee-+Wn`44AMK➝2BRՈt7g*1gph9N) *"TF*R(#'88pm=}X]u[i7bEc|\~EMn}P瘊J)K.0i1M6=7'_\kaZ(Th{K*GJyytw"IO-PWJk)..axӝ47"89Cc7ĐBiZx 7m!fy|ϿF9CbȩV 9V-՛^pV̌ɄS#Bv4-@]Vxt-Z, &ֺ*diؠ2^VXbs֔Ìl.jQ]Y[47gj=幽ex)A0ip׳ W2[ᎇhuE^~q흙L} #-b۸oFJ_QP3r6jr+"nfzRJTUqoaۍ /$d8Mx'ݓ= OՃ| )$2mcM*cЙj}f };n YG w0Ia!1Q.oYfr]DyISaP}"dIӗթO67jqR ҊƐƈaɤGG|h;t]䗖oSv|iZqX)oalv;۩meEJ\!8=$4QU4Xo&VEĊ YS^E#d,yX_> ۘ-e\ "Wa6uLĜZi`aD9.% w~mB(02G[6y.773a7 /=o7D)$Z 66 $bY^\CuP. (x'"J60׿Y:Oi;F{w佩b+\Yi`TDWa~|VH)8q/=9!g߆2Y)?ND)%?Ǐ`k/sn:;O299yB=a[Ng 3˲N}vLNy;*?x?~L&=xyӴ~}q{qE*IQ^^ͧvü{Huu=R|>JyUlZV, B~/YF!Y\u_ݼF{_C)LD]m {H 0ihhadd nUkf3oٺCvE\)QJi+֥@tDJkB$1!Đr0XQ|q?d2) Ӣ_}qv-< FŊ߫%roppVBwü~JidY4:}L6M7f٬F "?71<2#?Jyy4뷢<_a7_=Q E=S1И/9{+93֮E{ǂw{))?maÆm(uLE#lïZ  ~d];+]h j?!|$F}*"4(v'8s<ŏUkm7^7no1w2ؗ}TrͿEk>p'8OB7d7R(A 9.*Mi^ͳ; eeUwS+C)uO@ =Sy]` }l8^ZzRXj[^iUɺ$tj))<sbDJfg=Pk_{xaKo1:-uyG0M ԃ\0Lvuy'ȱc2Ji AdyVgVh!{]/&}}ċJ#%d !+87<;qN޼Nفl|1N:8ya  8}k¾+-$4FiZYÔXk*I&'@iI99)HSh4+2G:tGhS^繿 Kتm0 вDk}֚+QT4;sC}rՅE,8CX-e~>G&'9xpW,%Fh,Ry56Y–hW-(v_,? ; qrBk4-V7HQ;ˇ^Gv1JVV%,ik;D_W!))+BoS4QsTM;gt+ndS-~:11Sgv!0qRVh!"Ȋ(̦Yl.]PQWgٳE'`%W1{ndΗBk|Ž7ʒR~,lnoa&:ü$ 3<a[CBݮwt"o\ePJ=Hz"_c^Z.#ˆ*x z̝grY]tdkP*:97YľXyBkD4N.C_[;F9`8& !AMO c `@BA& Ost\-\NX+Xp < !bj3C&QL+*&kAQ=04}cC!9~820G'PC9xa!w&bo_1 Sw"ܱ V )Yl3+ס2KoXOx]"`^WOy :3GO0g;%Yv㐫(R/r (s } u B &FeYZh0y> =2<Ϟc/ -u= c&׭,.0"g"7 6T!vl#sc>{u/Oh Bᾈ)۴74]x7 gMӒ"d]U)}" v4co[ ɡs 5Gg=XR14?5A}D "b{0$L .\4y{_fe:kVS\\O]c^W52LSBDM! C3Dhr̦RtArx4&agaN3Cf<Ԉp4~ B'"1@.b_/xQ} _߃҉/gٓ2Qkqp0շpZ2fԫYz< 4L.Cyυι1t@鎫Fe sYfsF}^ V}N<_`p)alٶ "(XEAVZ<)2},:Ir*#m_YӼ R%a||EƼIJ,,+f"96r/}0jE/)s)cjW#w'Sʯ5<66lj$a~3Kʛy 2:cZ:Yh))+a߭K::N,Q F'qB]={.]h85C9cr=}*rk?vwV렵ٸW Rs%}rNAkDv|uFLBkWY YkX מ|)1!$#3%y?pF<@<Rr0}: }\J [5FRxY<9"SQdE(Q*Qʻ)q1E0B_O24[U'],lOb ]~WjHޏTQ5Syu wq)xnw8~)c 쫬gٲߠ H% k5dƝk> kEj,0% b"vi2Wس_CuK)K{n|>t{P1򨾜j>'kEkƗBg*H%'_aY6Bn!TL&ɌOb{c`'d^{t\i^[uɐ[}q0lM˕G:‚4kb祔c^:?bpg… +37stH:0}en6x˟%/<]BL&* 5&fK9Mq)/iyqtA%kUe[ڛKN]Ě^,"`/ s[EQQm?|XJ߅92m]G.E΃ח U*Cn.j_)Tѧj̿30ڇ!A0=͜ar I3$C^-9#|pk!)?7.x9 @OO;WƝZBFU keZ75F6Tc6"ZȚs2y/1 ʵ:u4xa`C>6Rb/Yм)^=+~uRd`/|_8xbB0?Ft||Z\##|K 0>>zxv8۴吅q 8ĥ)"6>~\8:qM}#͚'ĉ#p\׶ l#bA?)|g g9|8jP(cr,BwV (WliVxxᡁ@0Okn;ɥh$_ckCgriv}>=wGzβ KkBɛ[˪ !J)h&k2%07δt}!d<9;I&0wV/ v 0<H}L&8ob%Hi|޶o&h1L|u֦y~󛱢8fٲUsւ)0oiFx2}X[zVYr_;N(w]_4B@OanC?gĦx>мgx>ΛToZoOMp>40>V Oy V9iq!4 LN,ˢu{jsz]|"R޻&'ƚ{53ўFu(<٪9:΋]B;)B>1::8;~)Yt|0(pw2N%&X,URBK)3\zz&}ax4;ǟ(tLNg{N|Ǽ\G#C9g$^\}p?556]/RP.90 k,U8/u776s ʪ_01چ|\N 0VV*3H鴃J7iI!wG_^ypl}r*jɤSR 5QN@ iZ#1ٰy;_\3\BQQ x:WJv츟ٯ$"@6 S#qe딇(/P( Dy~TOϻ<4:-+F`0||;Xl-"uw$Цi󼕝mKʩorz"mϺ$F:~E'ҐvD\y?Rr8_He@ e~O,T.(ފR*cY^m|cVR[8 JҡSm!ΆԨb)RHG{?MpqrmN>߶Y)\p,d#xۆWY*,l6]v0h15M˙MS8+EdI='LBJIH7_9{Caз*Lq,dt >+~ّeʏ?xԕ4bBAŚjﵫ!'\Ը$WNvKO}ӽmSşذqsOy?\[,d@'73'j%kOe`1.g2"e =YIzS2|zŐƄa\U,dP;jhhhaxǶ?КZ՚.q SE+XrbOu%\GتX(H,N^~]JyEZQKceTQ]VGYqnah;y$cQahT&QPZ*iZ8UQQM.qo/T\7X"u?Mttl2Xq(IoW{R^ ux*SYJ! 4S.Jy~ BROS[V|žKNɛP(L6V^|cR7i7nZW1Fd@ Ara{詑|(T*dN]Ko?s=@ |_EvF]׍kR)eBJc" MUUbY6`~V޴dJKß&~'d3i WWWWWW
Current Directory: /opt/cloudlinux/venv/lib/python3.11/site-packages/numpy/distutils
Viewing File: /opt/cloudlinux/venv/lib/python3.11/site-packages/numpy/distutils/npy_pkg_config.py
import sys import re import os from configparser import RawConfigParser __all__ = ['FormatError', 'PkgNotFound', 'LibraryInfo', 'VariableSet', 'read_config', 'parse_flags'] _VAR = re.compile(r'\$\{([a-zA-Z0-9_-]+)\}') class FormatError(OSError): """ Exception thrown when there is a problem parsing a configuration file. """ def __init__(self, msg): self.msg = msg def __str__(self): return self.msg class PkgNotFound(OSError): """Exception raised when a package can not be located.""" def __init__(self, msg): self.msg = msg def __str__(self): return self.msg def parse_flags(line): """ Parse a line from a config file containing compile flags. Parameters ---------- line : str A single line containing one or more compile flags. Returns ------- d : dict Dictionary of parsed flags, split into relevant categories. These categories are the keys of `d`: * 'include_dirs' * 'library_dirs' * 'libraries' * 'macros' * 'ignored' """ d = {'include_dirs': [], 'library_dirs': [], 'libraries': [], 'macros': [], 'ignored': []} flags = (' ' + line).split(' -') for flag in flags: flag = '-' + flag if len(flag) > 0: if flag.startswith('-I'): d['include_dirs'].append(flag[2:].strip()) elif flag.startswith('-L'): d['library_dirs'].append(flag[2:].strip()) elif flag.startswith('-l'): d['libraries'].append(flag[2:].strip()) elif flag.startswith('-D'): d['macros'].append(flag[2:].strip()) else: d['ignored'].append(flag) return d def _escape_backslash(val): return val.replace('\\', '\\\\') class LibraryInfo: """ Object containing build information about a library. Parameters ---------- name : str The library name. description : str Description of the library. version : str Version string. sections : dict The sections of the configuration file for the library. The keys are the section headers, the values the text under each header. vars : class instance A `VariableSet` instance, which contains ``(name, value)`` pairs for variables defined in the configuration file for the library. requires : sequence, optional The required libraries for the library to be installed. Notes ----- All input parameters (except "sections" which is a method) are available as attributes of the same name. """ def __init__(self, name, description, version, sections, vars, requires=None): self.name = name self.description = description if requires: self.requires = requires else: self.requires = [] self.version = version self._sections = sections self.vars = vars def sections(self): """ Return the section headers of the config file. Parameters ---------- None Returns ------- keys : list of str The list of section headers. """ return list(self._sections.keys()) def cflags(self, section="default"): val = self.vars.interpolate(self._sections[section]['cflags']) return _escape_backslash(val) def libs(self, section="default"): val = self.vars.interpolate(self._sections[section]['libs']) return _escape_backslash(val) def __str__(self): m = ['Name: %s' % self.name, 'Description: %s' % self.description] if self.requires: m.append('Requires:') else: m.append('Requires: %s' % ",".join(self.requires)) m.append('Version: %s' % self.version) return "\n".join(m) class VariableSet: """ Container object for the variables defined in a config file. `VariableSet` can be used as a plain dictionary, with the variable names as keys. Parameters ---------- d : dict Dict of items in the "variables" section of the configuration file. """ def __init__(self, d): self._raw_data = dict([(k, v) for k, v in d.items()]) self._re = {} self._re_sub = {} self._init_parse() def _init_parse(self): for k, v in self._raw_data.items(): self._init_parse_var(k, v) def _init_parse_var(self, name, value): self._re[name] = re.compile(r'\$\{%s\}' % name) self._re_sub[name] = value def interpolate(self, value): # Brute force: we keep interpolating until there is no '${var}' anymore # or until interpolated string is equal to input string def _interpolate(value): for k in self._re.keys(): value = self._re[k].sub(self._re_sub[k], value) return value while _VAR.search(value): nvalue = _interpolate(value) if nvalue == value: break value = nvalue return value def variables(self): """ Return the list of variable names. Parameters ---------- None Returns ------- names : list of str The names of all variables in the `VariableSet` instance. """ return list(self._raw_data.keys()) # Emulate a dict to set/get variables values def __getitem__(self, name): return self._raw_data[name] def __setitem__(self, name, value): self._raw_data[name] = value self._init_parse_var(name, value) def parse_meta(config): if not config.has_section('meta'): raise FormatError("No meta section found !") d = dict(config.items('meta')) for k in ['name', 'description', 'version']: if not k in d: raise FormatError("Option %s (section [meta]) is mandatory, " "but not found" % k) if not 'requires' in d: d['requires'] = [] return d def parse_variables(config): if not config.has_section('variables'): raise FormatError("No variables section found !") d = {} for name, value in config.items("variables"): d[name] = value return VariableSet(d) def parse_sections(config): return meta_d, r def pkg_to_filename(pkg_name): return "%s.ini" % pkg_name def parse_config(filename, dirs=None): if dirs: filenames = [os.path.join(d, filename) for d in dirs] else: filenames = [filename] config = RawConfigParser() n = config.read(filenames) if not len(n) >= 1: raise PkgNotFound("Could not find file(s) %s" % str(filenames)) # Parse meta and variables sections meta = parse_meta(config) vars = {} if config.has_section('variables'): for name, value in config.items("variables"): vars[name] = _escape_backslash(value) # Parse "normal" sections secs = [s for s in config.sections() if not s in ['meta', 'variables']] sections = {} requires = {} for s in secs: d = {} if config.has_option(s, "requires"): requires[s] = config.get(s, 'requires') for name, value in config.items(s): d[name] = value sections[s] = d return meta, vars, sections, requires def _read_config_imp(filenames, dirs=None): def _read_config(f): meta, vars, sections, reqs = parse_config(f, dirs) # recursively add sections and variables of required libraries for rname, rvalue in reqs.items(): nmeta, nvars, nsections, nreqs = _read_config(pkg_to_filename(rvalue)) # Update var dict for variables not in 'top' config file for k, v in nvars.items(): if not k in vars: vars[k] = v # Update sec dict for oname, ovalue in nsections[rname].items(): if ovalue: sections[rname][oname] += ' %s' % ovalue return meta, vars, sections, reqs meta, vars, sections, reqs = _read_config(filenames) # FIXME: document this. If pkgname is defined in the variables section, and # there is no pkgdir variable defined, pkgdir is automatically defined to # the path of pkgname. This requires the package to be imported to work if not 'pkgdir' in vars and "pkgname" in vars: pkgname = vars["pkgname"] if not pkgname in sys.modules: raise ValueError("You should import %s to get information on %s" % (pkgname, meta["name"])) mod = sys.modules[pkgname] vars["pkgdir"] = _escape_backslash(os.path.dirname(mod.__file__)) return LibraryInfo(name=meta["name"], description=meta["description"], version=meta["version"], sections=sections, vars=VariableSet(vars)) # Trivial cache to cache LibraryInfo instances creation. To be really # efficient, the cache should be handled in read_config, since a same file can # be parsed many time outside LibraryInfo creation, but I doubt this will be a # problem in practice _CACHE = {} def read_config(pkgname, dirs=None): """ Return library info for a package from its configuration file. Parameters ---------- pkgname : str Name of the package (should match the name of the .ini file, without the extension, e.g. foo for the file foo.ini). dirs : sequence, optional If given, should be a sequence of directories - usually including the NumPy base directory - where to look for npy-pkg-config files. Returns ------- pkginfo : class instance The `LibraryInfo` instance containing the build information. Raises ------ PkgNotFound If the package is not found. See Also -------- misc_util.get_info, misc_util.get_pkg_info Examples -------- >>> npymath_info = np.distutils.npy_pkg_config.read_config('npymath') >>> type(npymath_info) <class 'numpy.distutils.npy_pkg_config.LibraryInfo'> >>> print(npymath_info) Name: npymath Description: Portable, core math library implementing C99 standard Requires: Version: 0.1 #random """ try: return _CACHE[pkgname] except KeyError: v = _read_config_imp(pkg_to_filename(pkgname), dirs) _CACHE[pkgname] = v return v # TODO: # - implements version comparison (modversion + atleast) # pkg-config simple emulator - useful for debugging, and maybe later to query # the system if __name__ == '__main__': from optparse import OptionParser import glob parser = OptionParser() parser.add_option("--cflags", dest="cflags", action="store_true", help="output all preprocessor and compiler flags") parser.add_option("--libs", dest="libs", action="store_true", help="output all linker flags") parser.add_option("--use-section", dest="section", help="use this section instead of default for options") parser.add_option("--version", dest="version", action="store_true", help="output version") parser.add_option("--atleast-version", dest="min_version", help="Minimal version") parser.add_option("--list-all", dest="list_all", action="store_true", help="Minimal version") parser.add_option("--define-variable", dest="define_variable", help="Replace variable with the given value") (options, args) = parser.parse_args(sys.argv) if len(args) < 2: raise ValueError("Expect package name on the command line:") if options.list_all: files = glob.glob("*.ini") for f in files: info = read_config(f) print("%s\t%s - %s" % (info.name, info.name, info.description)) pkg_name = args[1] d = os.environ.get('NPY_PKG_CONFIG_PATH') if d: info = read_config(pkg_name, ['numpy/core/lib/npy-pkg-config', '.', d]) else: info = read_config(pkg_name, ['numpy/core/lib/npy-pkg-config', '.']) if options.section: section = options.section else: section = "default" if options.define_variable: m = re.search(r'([\S]+)=([\S]+)', options.define_variable) if not m: raise ValueError("--define-variable option should be of " "the form --define-variable=foo=bar") else: name = m.group(1) value = m.group(2) info.vars[name] = value if options.cflags: print(info.cflags(section)) if options.libs: print(info.libs(section)) if options.version: print(info.version) if options.min_version: print(info.version >= options.min_version)